cas: 344411-08-1 — see every product listed under this CAS number, including other names
2-Fluoro-5-(trifluoromethoxy)benzyl alcohol, 95% (CAS 344411-08-1) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F342359-500MG |
| cas | 344411-08-1 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 310.33 Pln | |
| Fluorochem | 5g | 1924.34 Pln | |
| Fluorochem | 25g | 4012.15 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[2-fluoro-5-(trifluoromethoxy)phenyl]methanol (CAS 344411-08-1) is a chemical compound with the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. IUPAC name: [2-fluoro-5-(trifluoromethoxy)phenyl]methanol. InChIKey: BOTUFOKWIHWOKF-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O2 |
|---|---|
| Molecular weight | 210.13 g/mol |
| IUPAC name | [2-fluoro-5-(trifluoromethoxy)phenyl]methanol |
| InChIKey | BOTUFOKWIHWOKF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)CO)F |
Computed by PubChem (NCBI)