Products 344411-08-1
CAS 344411-08-1 appears in our catalog under these names: 2-Fluoro-5-(trifluoromethoxy)benzyl alcohol, 96%, (2-Fluoro-5-(trifluoromethoxy)phenyl)methanol 96%, (2-Fluoro-5-(trifluoromethoxy)phenyl)methanol, 96%, 96%, 2-Fluoro-5-(trifluoromethoxy)benzyl alcohol, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 250mg.
[2-fluoro-5-(trifluoromethoxy)phenyl]methanol (CAS 344411-08-1) is a chemical compound with the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. IUPAC name: [2-fluoro-5-(trifluoromethoxy)phenyl]methanol. InChIKey: BOTUFOKWIHWOKF-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O2 |
|---|---|
| Molecular weight | 210.13 g/mol |
| IUPAC name | [2-fluoro-5-(trifluoromethoxy)phenyl]methanol |
| InChIKey | BOTUFOKWIHWOKF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)CO)F |
Computed by PubChem (NCBI)