cas: 1218790-89-6 — see every product listed under this CAS number, including other names
(2-Formyl-5-(trifluoromethoxy)phenyl)boronic acid (CAS 1218790-89-6) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F338073-5G |
| cas | 1218790-89-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1486.99 Pln |
| delivery time | 3-4 weeks |
|---|
[2-formyl-5-(trifluoromethoxy)phenyl]boronic acid (CAS 1218790-89-6) is a chemical compound with the molecular formula C8H6BF3O4 and a molecular weight of 233.94 g/mol. IUPAC name: [2-formyl-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: GZRIYFFBRIQGSC-UHFFFAOYSA-N.
| Molecular formula | C8H6BF3O4 |
|---|---|
| Molecular weight | 233.94 g/mol |
| IUPAC name | [2-formyl-5-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | GZRIYFFBRIQGSC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC(F)(F)F)C=O)(O)O |
Computed by PubChem (NCBI)