Products 1310383-91-5

CAS 1310383-91-5 appears in our catalog under these names: 3-Formyl-4-(trifluoromethoxy)phenylboronic acid, 97%, (3-Formyl-4-(trifluoromethoxy)phenyl)boronic acid 97%, (3-Formyl-4-(trifluoromethoxy)phenyl)boronic acid. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

[3-formyl-4-(trifluoromethoxy)phenyl]boronic acid (CAS 1310383-91-5) is a chemical compound with the molecular formula C8H6BF3O4 and a molecular weight of 233.94 g/mol. IUPAC name: [3-formyl-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: NMDBNGRHYCPTCY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BF3O4
Molecular weight233.94 g/mol
IUPAC name[3-formyl-4-(trifluoromethoxy)phenyl]boronic acid
InChIKeyNMDBNGRHYCPTCY-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1)OC(F)(F)F)C=O)(O)O

Computed by PubChem (NCBI)