CAS 1218790-89-6 appears in our catalog under these names: 2-Formyl-5-(trifluoromethoxy)phenylboronic acid, 97%, (2-Formyl-5-(trifluoromethoxy)phenyl)boronic acid 97%, (2-Formyl-5-(trifluoromethoxy)phenyl)boronic acid. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g.
[2-formyl-5-(trifluoromethoxy)phenyl]boronic acid (CAS 1218790-89-6) is a chemical compound with the molecular formula C8H6BF3O4 and a molecular weight of 233.94 g/mol. IUPAC name: [2-formyl-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: GZRIYFFBRIQGSC-UHFFFAOYSA-N.
| Molecular formula | C8H6BF3O4 |
|---|---|
| Molecular weight | 233.94 g/mol |
| IUPAC name | [2-formyl-5-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | GZRIYFFBRIQGSC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC(F)(F)F)C=O)(O)O |
Computed by PubChem (NCBI)