Products 1050424-03-7
CAS 1050424-03-7 appears in our catalog under these names: 4-Borono-2-(trifluoromethyl)benzoic acid, 97%, 4-Borono-2-(trifluoromethyl)benzoic Acid, 4-Borono-2-(trifluoromethyl)benzoic acid 98%, 4-Borono-2-(trifluoromethyl)benzoic acid, 98%, 98%, 4-Borono-2-(trifluoromethyl)benzoic acid, 98%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 5g, 1g, 100mg, 500mg.
4-borono-2-(trifluoromethyl)benzoic acid (CAS 1050424-03-7) is a chemical compound with the molecular formula C8H6BF3O4 and a molecular weight of 233.94 g/mol. IUPAC name: 4-borono-2-(trifluoromethyl)benzoic acid. InChIKey: WYTZBGVJUBFOBU-UHFFFAOYSA-N.
| Molecular formula | C8H6BF3O4 |
|---|---|
| Molecular weight | 233.94 g/mol |
| IUPAC name | 4-borono-2-(trifluoromethyl)benzoic acid |
| InChIKey | WYTZBGVJUBFOBU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)O)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)