cas: 25373-56-2 — see every product listed under this CAS number, including other names
(2-Imidazol-1-yl-phenyl)methanol 95% (CAS 25373-56-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A222446-250mg |
| cas | 25373-56-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 726.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A222446 |
(2-imidazol-1-ylphenyl)methanol (CAS 25373-56-2) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: (2-imidazol-1-ylphenyl)methanol. InChIKey: GQEOSWPDJPLJQU-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | (2-imidazol-1-ylphenyl)methanol |
| InChIKey | GQEOSWPDJPLJQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CO)N2C=CN=C2 |
Computed by PubChem (NCBI)