CAS 25373-56-2 appears in our catalog under these names: (2-Imidazol-1-yl-phenyl)methanol, 95%, (2-Imidazol-1-yl-phenyl)methanol 95%, (2-Imidazol-1-yl-phenyl)methanol, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg.
(2-imidazol-1-ylphenyl)methanol (CAS 25373-56-2) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: (2-imidazol-1-ylphenyl)methanol. InChIKey: GQEOSWPDJPLJQU-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | (2-imidazol-1-ylphenyl)methanol |
| InChIKey | GQEOSWPDJPLJQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CO)N2C=CN=C2 |
Computed by PubChem (NCBI)