cas: 2096331-64-3 — see every product listed under this CAS number, including other names
(2-Isobutoxy-4-(trifluoromethyl)phenyl)boronic acid 97% (CAS 2096331-64-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A499450-250mg |
| cas | 2096331-64-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A499450 |
[2-(2-methylpropoxy)-4-(trifluoromethyl)phenyl]boronic acid (CAS 2096331-64-3) is a chemical compound with the molecular formula C11H14BF3O3 and a molecular weight of 262.04 g/mol. IUPAC name: [2-(2-methylpropoxy)-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: HNSBTOIZQFKAHB-UHFFFAOYSA-N.
| Molecular formula | C11H14BF3O3 |
|---|---|
| Molecular weight | 262.04 g/mol |
| IUPAC name | [2-(2-methylpropoxy)-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | HNSBTOIZQFKAHB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(F)(F)F)OCC(C)C)(O)O |
Computed by PubChem (NCBI)