Products 2096333-69-4
CAS 2096333-69-4 appears in our catalog under these names: 3-Isobutoxy-4-(trifluoromethyl)phenylboronic acid, 98%, (3-Isobutoxy-4-(trifluoromethyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
[3-(2-methylpropoxy)-4-(trifluoromethyl)phenyl]boronic acid (CAS 2096333-69-4) is a chemical compound with the molecular formula C11H14BF3O3 and a molecular weight of 262.04 g/mol. IUPAC name: [3-(2-methylpropoxy)-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: JEYNJBYXUIEAPH-UHFFFAOYSA-N.
| Molecular formula | C11H14BF3O3 |
|---|---|
| Molecular weight | 262.04 g/mol |
| IUPAC name | [3-(2-methylpropoxy)-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | JEYNJBYXUIEAPH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(F)(F)F)OCC(C)C)(O)O |
Computed by PubChem (NCBI)