Products 1256345-98-8
CAS 1256345-98-8 is the registry number for 2-Butoxy-5-(trifluoromethyl)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g, 100g.
[2-butoxy-5-(trifluoromethyl)phenyl]boronic acid (CAS 1256345-98-8) is a chemical compound with the molecular formula C11H14BF3O3 and a molecular weight of 262.04 g/mol. IUPAC name: [2-butoxy-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: SZZLCARSUTXMQZ-UHFFFAOYSA-N.
| Molecular formula | C11H14BF3O3 |
|---|---|
| Molecular weight | 262.04 g/mol |
| IUPAC name | [2-butoxy-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | SZZLCARSUTXMQZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(F)(F)F)OCCCC)(O)O |
Computed by PubChem (NCBI)