CAS 1256345-99-9 appears in our catalog under these names: 2-Isobutoxy-5-(trifluoromethyl)phenylboronic acid, 95%, (2-Isobutoxy-5-(trifluoromethyl)phenyl)boronic acid, 95%, (2-Isobutoxy-5-(trifluoromethyl)phenyl)boronic acid 95%, 2-Isobutoxy-5-(trifluoromethyl)phenylboronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg.
[2-(2-methylpropoxy)-5-(trifluoromethyl)phenyl]boronic acid (CAS 1256345-99-9) is a chemical compound with the molecular formula C11H14BF3O3 and a molecular weight of 262.04 g/mol. IUPAC name: [2-(2-methylpropoxy)-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: YYWZYPLOMFBKDT-UHFFFAOYSA-N.
| Molecular formula | C11H14BF3O3 |
|---|---|
| Molecular weight | 262.04 g/mol |
| IUPAC name | [2-(2-methylpropoxy)-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | YYWZYPLOMFBKDT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(F)(F)F)OCC(C)C)(O)O |
Computed by PubChem (NCBI)