cas: 5804-49-9 — see every product listed under this CAS number, including other names
(2-Methoxy-5-nitrophenyl)methanol 97% (CAS 5804-49-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A151864-100mg |
| cas | 5804-49-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 414.88 Pln | |
| Ambeed | 5g | 1783.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A151864 |
(2-methoxy-5-nitrophenyl)methanol (CAS 5804-49-9) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: (2-methoxy-5-nitrophenyl)methanol. InChIKey: NDVYUOCVDRLAPG-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | (2-methoxy-5-nitrophenyl)methanol |
| InChIKey | NDVYUOCVDRLAPG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)