CAS 76470-34-3 appears in our catalog under these names: 5,6-Dimethoxynicotinic acid, 96%, 5,6-Dimethoxynicotinic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 5g.
5,6-dimethoxypyridine-3-carboxylic acid (CAS 76470-34-3) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 5,6-dimethoxypyridine-3-carboxylic acid. InChIKey: DVPUSKADCOGLKP-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 5,6-dimethoxypyridine-3-carboxylic acid |
| InChIKey | DVPUSKADCOGLKP-UHFFFAOYSA-N |
| SMILES | COC1=C(N=CC(=C1)C(=O)O)OC |
Computed by PubChem (NCBI)