Products 76470-34-3

CAS 76470-34-3 appears in our catalog under these names: 5,6-Dimethoxynicotinic acid, 96%, 5,6-Dimethoxynicotinic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

5,6-dimethoxypyridine-3-carboxylic acid (CAS 76470-34-3) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 5,6-dimethoxypyridine-3-carboxylic acid. InChIKey: DVPUSKADCOGLKP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO4
Molecular weight183.16 g/mol
IUPAC name5,6-dimethoxypyridine-3-carboxylic acid
InChIKeyDVPUSKADCOGLKP-UHFFFAOYSA-N
SMILESCOC1=C(N=CC(=C1)C(=O)O)OC

Computed by PubChem (NCBI)