CAS 90764-84-4 appears in our catalog under these names: 4,6-Dimethoxypicolinic acid, 95%, 4,6–Dimethoxypicolinic acid, 4,6-Dimethoxypicolinic acid, 4,6-Dimethoxypicolinic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 0,25g, 0,1g, 0,5g, 2g.
4,6-dimethoxypyridine-2-carboxylic acid (CAS 90764-84-4) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 4,6-dimethoxypyridine-2-carboxylic acid. InChIKey: OCOFPEDHFWODKY-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 4,6-dimethoxypyridine-2-carboxylic acid |
| InChIKey | OCOFPEDHFWODKY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC(=C1)OC)C(=O)O |
Computed by PubChem (NCBI)