Products 1256788-45-0

CAS 1256788-45-0 appears in our catalog under these names: 2,5-Dimethoxypyridine-3-carboxylic acid, 96%, 2,5-Dimethoxynicotinic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2,5-dimethoxypyridine-3-carboxylic acid (CAS 1256788-45-0) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 2,5-dimethoxypyridine-3-carboxylic acid. InChIKey: WOYHARVFNMHRFT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO4
Molecular weight183.16 g/mol
IUPAC name2,5-dimethoxypyridine-3-carboxylic acid
InChIKeyWOYHARVFNMHRFT-UHFFFAOYSA-N
SMILESCOC1=CC(=C(N=C1)OC)C(=O)O

Computed by PubChem (NCBI)