CAS 1256788-45-0 appears in our catalog under these names: 2,5-Dimethoxypyridine-3-carboxylic acid, 96%, 2,5-Dimethoxynicotinic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2,5-dimethoxypyridine-3-carboxylic acid (CAS 1256788-45-0) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 2,5-dimethoxypyridine-3-carboxylic acid. InChIKey: WOYHARVFNMHRFT-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 2,5-dimethoxypyridine-3-carboxylic acid |
| InChIKey | WOYHARVFNMHRFT-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(N=C1)OC)C(=O)O |
Computed by PubChem (NCBI)