cas: 1400764-43-3 — see every product listed under this CAS number, including other names
(2-Methyl-2H-indazol-7-yl)methanamine hydrochloride, 97% (CAS 1400764-43-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A227049-10g |
| cas | 1400764-43-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 18441.22 Pln | |
| AmBeed | 5g | 12347.86 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2-methylindazol-7-yl)methanamine;hydrochloride (CAS 1400764-43-3) is a chemical compound with the molecular formula C9H12ClN3 and a molecular weight of 197.66 g/mol. IUPAC name: (2-methylindazol-7-yl)methanamine;hydrochloride. InChIKey: HUKPYUGOFJRIDJ-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | (2-methylindazol-7-yl)methanamine;hydrochloride |
| InChIKey | HUKPYUGOFJRIDJ-UHFFFAOYSA-N |
| SMILES | CN1C=C2C=CC=C(C2=N1)CN.Cl |
Computed by PubChem (NCBI)