CAS 87394-54-5 appears in our catalog under these names: 1-(6-Chloro-pyridin-2-yl)-piperazine, 96%, 1-(6-Chloropyridin-2-yl)piperazine, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 10g, 1g, 250mg.
1-(6-chloro-2-pyridinyl)piperazine (CAS 87394-54-5) is a chemical compound with the molecular formula C9H12ClN3 and a molecular weight of 197.66 g/mol. IUPAC name: 1-(6-chloro-2-pyridinyl)piperazine. InChIKey: KQFRTJUIRPBBAB-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 1-(6-chloro-2-pyridinyl)piperazine |
| InChIKey | KQFRTJUIRPBBAB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC(=CC=C2)Cl |
Computed by PubChem (NCBI)