cas: 444722-03-6 — see every product listed under this CAS number, including other names
(2-Methyl-4-(methylthio)phenyl)boronic acid 97% (CAS 444722-03-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A105903-250mg |
| cas | 444722-03-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1460.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A105903 |
(2-methyl-4-methylsulfanylphenyl)boronic acid (CAS 444722-03-6) is a chemical compound with the molecular formula C8H11BO2S and a molecular weight of 182.05 g/mol. IUPAC name: (2-methyl-4-methylsulfanylphenyl)boronic acid. InChIKey: HVNDQDBZHJIHLK-UHFFFAOYSA-N.
| Molecular formula | C8H11BO2S |
|---|---|
| Molecular weight | 182.05 g/mol |
| IUPAC name | (2-methyl-4-methylsulfanylphenyl)boronic acid |
| InChIKey | HVNDQDBZHJIHLK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)SC)C)(O)O |
Computed by PubChem (NCBI)