CAS 221031-07-8 appears in our catalog under these names: 3-Methyl-4-(methylsulfanyl)phenylboronic acid, 96%, (3-Methyl-4-(methylthio)phenyl)boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
(3-methyl-4-methylsulfanylphenyl)boronic acid (CAS 221031-07-8) is a chemical compound with the molecular formula C8H11BO2S and a molecular weight of 182.05 g/mol. IUPAC name: (3-methyl-4-methylsulfanylphenyl)boronic acid. InChIKey: MKFDONWOZBIQGF-UHFFFAOYSA-N.
| Molecular formula | C8H11BO2S |
|---|---|
| Molecular weight | 182.05 g/mol |
| IUPAC name | (3-methyl-4-methylsulfanylphenyl)boronic acid |
| InChIKey | MKFDONWOZBIQGF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)SC)C)(O)O |
Computed by PubChem (NCBI)