CAS 444722-03-6 appears in our catalog under these names: [2-Methyl-4-(methylsulfanyl)phenyl]boronic acid, 97%, (2-Methyl-4-(methylthio)phenyl)boronic acid 97%, [2-methyl-4-(methylsulfanyl)phenyl]boronic acid, ≥95%, ≥95%, (2-Methyl-4-(methylthio)phenyl)boronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
(2-methyl-4-methylsulfanylphenyl)boronic acid (CAS 444722-03-6) is a chemical compound with the molecular formula C8H11BO2S and a molecular weight of 182.05 g/mol. IUPAC name: (2-methyl-4-methylsulfanylphenyl)boronic acid. InChIKey: HVNDQDBZHJIHLK-UHFFFAOYSA-N.
| Molecular formula | C8H11BO2S |
|---|---|
| Molecular weight | 182.05 g/mol |
| IUPAC name | (2-methyl-4-methylsulfanylphenyl)boronic acid |
| InChIKey | HVNDQDBZHJIHLK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)SC)C)(O)O |
Computed by PubChem (NCBI)