Products 362045-33-8

CAS 362045-33-8 appears in our catalog under these names: 2-(Ethylthio)phenylboronic acid 95%, 2-(Ethylthio)phenylboronic acid, 95%, 95%, 2-(Ethylthio)phenylboronic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.

Structural formula: {0} (CAS {1})

(2-ethylsulfanylphenyl)boronic acid (CAS 362045-33-8) is a chemical compound with the molecular formula C8H11BO2S and a molecular weight of 182.05 g/mol. IUPAC name: (2-ethylsulfanylphenyl)boronic acid. InChIKey: SCGSNVLNGRYSAA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11BO2S
Molecular weight182.05 g/mol
IUPAC name(2-ethylsulfanylphenyl)boronic acid
InChIKeySCGSNVLNGRYSAA-UHFFFAOYSA-N
SMILESB(C1=CC=CC=C1SCC)(O)O

Computed by PubChem (NCBI)