cas: 1544673-46-2 — see every product listed under this CAS number, including other names
(2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanol, 98% (CAS 1544673-46-2) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F617378-500MG |
| cas | 1544673-46-2 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 253.05 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 2.5g | 596.68 Pln | |
| Fluorochem | 5g | 784.12 Pln | |
| Fluorochem | 10g | 1476.58 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol (CAS 1544673-46-2) is a chemical compound with the molecular formula C14H21BO3 and a molecular weight of 248.13 g/mol. IUPAC name: [2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol. InChIKey: HLEBNLQFGHQIKK-UHFFFAOYSA-N.
| Molecular formula | C14H21BO3 |
|---|---|
| Molecular weight | 248.13 g/mol |
| IUPAC name | [2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
| InChIKey | HLEBNLQFGHQIKK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C)CO |
Computed by PubChem (NCBI)