CAS 475250-52-3 appears in our catalog under these names: 4-Methoxybenzylboronic acid pinacol ester, 97%, 4-Methoxybenzylboronic acid pinacol ester, 95-<97%, 4-Methoxybenzylboronic acid pinacol ester, ≥97-<99%, 2–(4–Methoxybenzyl)–4,4,5,5–tetramethyl–1,3,2–dioxaborolane, 4-Methoxybenzylboronic acid pinacolester. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Biosynth, TCI. Available pack sizes: 1g, 25g, 10g, 5g, 50g, 100g, 200g, 300g.
2-[(4-methoxyphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 475250-52-3) is a chemical compound with the molecular formula C14H21BO3 and a molecular weight of 248.13 g/mol. IUPAC name: 2-[(4-methoxyphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HPNLRRQVSZVKHY-UHFFFAOYSA-N.
| Molecular formula | C14H21BO3 |
|---|---|
| Molecular weight | 248.13 g/mol |
| IUPAC name | 2-[(4-methoxyphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HPNLRRQVSZVKHY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)