Products 475250-52-3

CAS 475250-52-3 appears in our catalog under these names: 4-Methoxybenzylboronic acid pinacol ester, 97%, 4-Methoxybenzylboronic acid pinacol ester, 95-<97%, 4-Methoxybenzylboronic acid pinacol ester, ≥97-<99%, 2–(4–Methoxybenzyl)–4,4,5,5–tetramethyl–1,3,2–dioxaborolane, 4-Methoxybenzylboronic acid pinacolester. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Biosynth, TCI. Available pack sizes: 1g, 25g, 10g, 5g, 50g, 100g, 200g, 300g.

Structural formula: {0} (CAS {1})

2-[(4-methoxyphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 475250-52-3) is a chemical compound with the molecular formula C14H21BO3 and a molecular weight of 248.13 g/mol. IUPAC name: 2-[(4-methoxyphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HPNLRRQVSZVKHY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21BO3
Molecular weight248.13 g/mol
IUPAC name2-[(4-methoxyphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
InChIKeyHPNLRRQVSZVKHY-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)CC2=CC=C(C=C2)OC

Computed by PubChem (NCBI)