CAS 797762-23-3 appears in our catalog under these names: 3-Methoxybenzylboronic acid pinacol ester, 98%, 3-Methoxybenzylboronic acid pinacol ester, 95-<97%, 3-Methoxybenzylboronic acid pinacol ester, ≥97-<99%, (3-Methoxybenzyl)boronic Acid Pinacol Ester 97%, 2-(3-Methoxybenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 5g, 1g, 2,5g, 10g, 25g, 50g, 100g.
2-[(3-methoxyphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 797762-23-3) is a chemical compound with the molecular formula C14H21BO3 and a molecular weight of 248.13 g/mol. IUPAC name: 2-[(3-methoxyphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: PEWMYAHTUICUAM-UHFFFAOYSA-N.
| Molecular formula | C14H21BO3 |
|---|---|
| Molecular weight | 248.13 g/mol |
| IUPAC name | 2-[(3-methoxyphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | PEWMYAHTUICUAM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC(=CC=C2)OC |
Computed by PubChem (NCBI)