cas: 871333-00-5 — see every product listed under this CAS number, including other names
(2-Methyl-5-(piperidin-1-ylsulfonyl)phenyl)boronic acid 98% (CAS 871333-00-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A564286-100mg |
| cas | 871333-00-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2584.25 Pln | |
| Ambeed | 25g | 8869.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A564286 |
(2-methyl-5-piperidin-1-ylsulfonylphenyl)boronic acid (CAS 871333-00-5) is a chemical compound with the molecular formula C12H18BNO4S and a molecular weight of 283.16 g/mol. IUPAC name: (2-methyl-5-piperidin-1-ylsulfonylphenyl)boronic acid. InChIKey: QPJRVQFTOJXHOV-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4S |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | (2-methyl-5-piperidin-1-ylsulfonylphenyl)boronic acid |
| InChIKey | QPJRVQFTOJXHOV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)S(=O)(=O)N2CCCCC2)C)(O)O |
Computed by PubChem (NCBI)