Products 871329-66-7
CAS 871329-66-7 appears in our catalog under these names: N-Cyclohexyl 4-boronobenzenesulfonamide, 95%, (4-(N-Cyclohexylsulfamoyl)phenyl)boronic acid, 98%, (4–(cyclohexylsulfamoyl)phenyl)boronic acid, (4-(N-Cyclohexylsulfamoyl)phenyl)boronic acid, 95%, 95%, (4-(N-Cyclohexylsulfamoyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 500g, 1g, 250mg, 100mg.
[4-(cyclohexylsulfamoyl)phenyl]boronic acid (CAS 871329-66-7) is a chemical compound with the molecular formula C12H18BNO4S and a molecular weight of 283.16 g/mol. IUPAC name: [4-(cyclohexylsulfamoyl)phenyl]boronic acid. InChIKey: XYWYVMPPDKSUFJ-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4S |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | [4-(cyclohexylsulfamoyl)phenyl]boronic acid |
| InChIKey | XYWYVMPPDKSUFJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC2CCCCC2)(O)O |
Computed by PubChem (NCBI)