CAS 1704066-99-8 appears in our catalog under these names: (3,5-Dimethyl-4-(pyrrolidin-1-ylsulfonyl)phenyl)boronic acid, 95%, (3,5-dimethyl-4-(pyrrolidin-1-ylsulfonyl)phenyl)boronic acid, 98+%, (3,5–Dimethyl–4–(pyrrolidin–1–ylsulfonyl)phenyl)boronic acid, Boronic acid, B-[3,5-dimethyl-4-(1-pyrrolidinylsulfonyl)phenyl]-, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
(3,5-dimethyl-4-pyrrolidin-1-ylsulfonylphenyl)boronic acid (CAS 1704066-99-8) is a chemical compound with the molecular formula C12H18BNO4S and a molecular weight of 283.16 g/mol. IUPAC name: (3,5-dimethyl-4-pyrrolidin-1-ylsulfonylphenyl)boronic acid. InChIKey: HCBGRLKZHUJREJ-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4S |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | (3,5-dimethyl-4-pyrrolidin-1-ylsulfonylphenyl)boronic acid |
| InChIKey | HCBGRLKZHUJREJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)S(=O)(=O)N2CCCC2)C)(O)O |
Computed by PubChem (NCBI)