CAS 871333-00-5 appears in our catalog under these names: 2-Methyl-5-(piperidin-1-ylsulfonyl)phenylboronic acid, 98%, (2-Methyl-5-(piperidin-1-ylsulfonyl)phenyl)boronic acid, 98%, 98%, (2-Methyl-5-(piperidin-1-ylsulfonyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg, 25g.
(2-methyl-5-piperidin-1-ylsulfonylphenyl)boronic acid (CAS 871333-00-5) is a chemical compound with the molecular formula C12H18BNO4S and a molecular weight of 283.16 g/mol. IUPAC name: (2-methyl-5-piperidin-1-ylsulfonylphenyl)boronic acid. InChIKey: QPJRVQFTOJXHOV-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4S |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | (2-methyl-5-piperidin-1-ylsulfonylphenyl)boronic acid |
| InChIKey | QPJRVQFTOJXHOV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)S(=O)(=O)N2CCCCC2)C)(O)O |
Computed by PubChem (NCBI)