(2-Phenoxybenzyl)hydrazine hydrochloride, 97%
cas: 2682114-51-6 — see every product listed under this CAS number, including other names
(2-Phenoxybenzyl)hydrazine hydrochloride, 97% (CAS 2682114-51-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1359533-250mg |
| cas | 2682114-51-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 570.62 Pln | |
| Ambeed | 5g | 1827.75 Pln | |
| Ambeed | 25g | 6044.12 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 5g | 1749.20 Pln | |
| Chemat | 25g | 5790.80 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 614.25 Pln | |
| BLDpharm | 5g | 1963.78 Pln | |
| BLDpharm | 25g | 6512.18 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2-phenoxyphenyl)methylhydrazine;hydrochloride (CAS 2682114-51-6) is a chemical compound with the molecular formula C13H15ClN2O and a molecular weight of 250.72 g/mol. IUPAC name: (2-phenoxyphenyl)methylhydrazine;hydrochloride. InChIKey: CPTIWJGMRHQFRX-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O |
|---|---|
| Molecular weight | 250.72 g/mol |
| IUPAC name | (2-phenoxyphenyl)methylhydrazine;hydrochloride |
| InChIKey | CPTIWJGMRHQFRX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2CNN.Cl |
Computed by PubChem (NCBI)