CAS 2173992-11-3 is the registry number for (1-(5-Chloro-1H-pyrrolo[2,3-b]pyridin-1-yl)cyclopentyl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[1-(5-chloropyrrolo[2,3-b]pyridin-1-yl)cyclopentyl]methanol (CAS 2173992-11-3) is a chemical compound with the molecular formula C13H15ClN2O and a molecular weight of 250.72 g/mol. IUPAC name: [1-(5-chloropyrrolo[2,3-b]pyridin-1-yl)cyclopentyl]methanol. InChIKey: JABFDKWTYUABBJ-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O |
|---|---|
| Molecular weight | 250.72 g/mol |
| IUPAC name | [1-(5-chloropyrrolo[2,3-b]pyridin-1-yl)cyclopentyl]methanol |
| InChIKey | JABFDKWTYUABBJ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(CO)N2C=CC3=CC(=CN=C32)Cl |
Computed by PubChem (NCBI)