Products 3566-44-7
CAS 3566-44-7 appears in our catalog under these names: Variamine blue b, 98%, Variation blue b (Redox indicator), 4-Amino-4'-methoxydiphenylamine HCl, Variamine Blue B [Redox Indicator], >98.0%(T), 1-N-(4-Methoxyphenyl)benzene-1,4-diamine hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 5g, 25g, 1g, 50g, 100g, 250mg.
4-N-(4-methoxyphenyl)benzene-1,4-diamine;hydrochloride (CAS 3566-44-7) is a chemical compound with the molecular formula C13H15ClN2O and a molecular weight of 250.72 g/mol. IUPAC name: 4-N-(4-methoxyphenyl)benzene-1,4-diamine;hydrochloride. InChIKey: HPQQXLXIGHOKNZ-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O |
|---|---|
| Molecular weight | 250.72 g/mol |
| IUPAC name | 4-N-(4-methoxyphenyl)benzene-1,4-diamine;hydrochloride |
| InChIKey | HPQQXLXIGHOKNZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Amino-4'-methoxydiphenylamine hydrochloride, N-(P-Methoxyphenyl)-P-Phenylenediamine Hydrochloride, N-(4-Methoxyphenyl)-1,4-benzenediamine hydrochloride, N-(4-Methoxyphenyl)benzene-1,4-diamine monohydrochloride, N-(P-METHOXYPHENYL)-P-PHENYLENEDIAMINE HYDROCHLORIDE [MI], 4Amino4'methoxydiphenylamine hydrochloride, N(4Methoxyphenyl)benzene1,4diamine monohydrochloride, 1,4Benzenediamine, N(4methoxyphenyl), monohydrochloride, VARIAMINE BLUE B BASE, Variamine Blue B