CAS 74144-49-3 appears in our catalog under these names: Dl-alanine beta-naphthylamide hydrochloride, 95%, H–DL–Ala–βNA · HCl, DL-alanine-beta-naphthylamide hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 5g, 2g, 10g, 25g.
2-amino-N-naphthalen-2-ylpropanamide;hydrochloride (CAS 74144-49-3) is a chemical compound with the molecular formula C13H15ClN2O and a molecular weight of 250.72 g/mol. IUPAC name: 2-amino-N-naphthalen-2-ylpropanamide;hydrochloride. InChIKey: WNLRRMRLNYQNOZ-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O |
|---|---|
| Molecular weight | 250.72 g/mol |
| IUPAC name | 2-amino-N-naphthalen-2-ylpropanamide;hydrochloride |
| InChIKey | WNLRRMRLNYQNOZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC2=CC=CC=C2C=C1)N.Cl |
Computed by PubChem (NCBI)