cas: 1367920-70-4 — see every product listed under this CAS number, including other names
(2-Phenylbenzo(d)oxazol-6-yl)methanamine, 95% (CAS 1367920-70-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A292265-1g |
| cas | 1367920-70-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 4978.54 Pln | |
| AmBeed | 10g | 38153.50 Pln | |
| AmBeed | 5g | 19619.53 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2-phenyl-1,3-benzoxazol-6-yl)methanamine (CAS 1367920-70-4) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: (2-phenyl-1,3-benzoxazol-6-yl)methanamine. InChIKey: IDWBCOMFDZWQEQ-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | (2-phenyl-1,3-benzoxazol-6-yl)methanamine |
| InChIKey | IDWBCOMFDZWQEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(O2)C=C(C=C3)CN |
Computed by PubChem (NCBI)