CAS 890985-45-2 is the registry number for 2-(3-Methylphenyl)-1,3-benzoxazol-6-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3-methylphenyl)-1,3-benzoxazol-6-amine (CAS 890985-45-2) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: 2-(3-methylphenyl)-1,3-benzoxazol-6-amine. InChIKey: CIXYEVORGNXLAD-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 2-(3-methylphenyl)-1,3-benzoxazol-6-amine |
| InChIKey | CIXYEVORGNXLAD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NC3=C(O2)C=C(C=C3)N |
Computed by PubChem (NCBI)