CAS 136257-31-3 appears in our catalog under these names: 1-Benzyl-1h-pyrrolo[2,3-b]pyridin-2(3h)-one, 95%, 1-Benzyl-1H-pyrrolo(2,3-b)pyridin-2(3H)-one, 97%, 1-Benzyl-1H-pyrrolo[2,3-b]pyridin-2(3H)-one, 97%, 97%, 1-Benzyl-1H-pyrrolo[2,3-b]pyridin-2(3H)-one, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g.
1-benzyl-3H-pyrrolo[2,3-b]pyridin-2-one (CAS 136257-31-3) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: 1-benzyl-3H-pyrrolo[2,3-b]pyridin-2-one. InChIKey: NQRONXBAZCQBDS-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 1-benzyl-3H-pyrrolo[2,3-b]pyridin-2-one |
| InChIKey | NQRONXBAZCQBDS-UHFFFAOYSA-N |
| SMILES | C1C2=C(N=CC=C2)N(C1=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)