Products 904817-08-9
CAS 904817-08-9 is the registry number for (3-Hydroxyphenyl)(phenylamino)acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 50mg.
2-anilino-2-(3-hydroxyphenyl)acetonitrile (CAS 904817-08-9) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: 2-anilino-2-(3-hydroxyphenyl)acetonitrile. InChIKey: KDZOTVHBVVFYNK-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 2-anilino-2-(3-hydroxyphenyl)acetonitrile |
| InChIKey | KDZOTVHBVVFYNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(C#N)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)