cas: 2322853-18-7 — see every product listed under this CAS number, including other names
(2R)-3-(1-bicyclo[1.1.1]pentanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid, 97% (CAS 2322853-18-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch134PM2-100mg |
| cas | 2322853-18-7 |
| size | 100mg |
| availability | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1595.60 Pln | |
| Chemat | 250mg | 2512.40 Pln | |
| Chemat | 500mg | 4106.00 Pln | |
| Chemat | 1g | 6189.20 Pln | |
| Fluorochem | 100mg | 2965.64 Pln | |
| Fluorochem | 250mg | 4652.55 Pln | |
| Fluorochem | 500mg | 7479.68 Pln | |
| Fluorochem | 1g | 11290.83 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-3-(1-bicyclo[1.1.1]pentanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 2322853-18-7) is a chemical compound with the molecular formula C23H23NO4 and a molecular weight of 377.4 g/mol. IUPAC name: (2R)-3-(1-bicyclo[1.1.1]pentanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: YLJCOQFCQRLDIZ-QDCNECIKSA-N.
| Molecular formula | C23H23NO4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (2R)-3-(1-bicyclo[1.1.1]pentanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | YLJCOQFCQRLDIZ-QDCNECIKSA-N |
| SMILES | C1C2CC1(C2)C[C@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)