Products 2095488-98-3
CAS 2095488-98-3 appears in our catalog under these names: Fmoc-L-Ala(BCP)-OH 97%, Fmoc-L-Ala(Bcp)-Oh, 97%, 97%, (2S)-3-(1-bicyclo[1.1.1]pentanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 500mg.
(2S)-3-(1-bicyclo[1.1.1]pentanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 2095488-98-3) is a chemical compound with the molecular formula C23H23NO4 and a molecular weight of 377.4 g/mol. IUPAC name: (2S)-3-(1-bicyclo[1.1.1]pentanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: YLJCOQFCQRLDIZ-UTHVCPNDSA-N.
| Molecular formula | C23H23NO4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (2S)-3-(1-bicyclo[1.1.1]pentanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | YLJCOQFCQRLDIZ-UTHVCPNDSA-N |
| SMILES | C1C2CC1(C2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)