cas: 335280-19-8 — see every product listed under this CAS number, including other names
(2R,3R)-1-(tert-Butoxycarbonyl)-3-hydroxypyrrolidine-2-carboxylic acid, 97%, 97% (CAS 335280-19-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CM0N-100mg |
| cas | 335280-19-8 |
| size | 100mg |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 500mg | 438.80 Pln | |
| Chemat | 1g | 683.60 Pln | |
| Chemat | 5g | 2382.80 Pln | |
| Chemat | 10g | 4470.80 Pln | |
| Chemat | 25g | 8334.80 Pln | |
| Chemat | 100g | 16298.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R,3R)-3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 335280-19-8) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (2R,3R)-3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: JLDHXHPQMBNKMC-RNFRBKRXSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (2R,3R)-3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | JLDHXHPQMBNKMC-RNFRBKRXSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H]1C(=O)O)O |
Computed by PubChem (NCBI)