CAS 1408074-43-0 appears in our catalog under these names: 2-(Boc-amino)-2-(oxetan-3-yl)acetic acid, 95%, 2-((tert-Butoxycarbonyl)amino)-2-(oxetan-3-yl)acetic acid, 97%, 2–((tert–Butoxycarbonyl)amino)–2–(oxetan–3–yl)acetic acid, Boc-DL-2-(oxetan-3-yl)-Gly-OH 95%, 2-((tert-Butoxycarbonyl)amino)-2-(oxetan-3-yl)acetic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg, 500mg, 25g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)acetic acid (CAS 1408074-43-0) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)acetic acid. InChIKey: ZGLWUVSYEVUTKH-UHFFFAOYSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)acetic acid |
| InChIKey | ZGLWUVSYEVUTKH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1COC1)C(=O)O |
Computed by PubChem (NCBI)