cas: 3019-58-7 — see every product listed under this CAS number, including other names
(2R,3R)-2,3-Dihydroxy-4-oxo-4-(phenylamino)butanoic acid, 98%, 98% (CAS 3019-58-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BOA-1g |
| cas | 3019-58-7 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 837.20 Pln | |
| Chemat | 10g | 1451.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R,3R)-4-anilino-2,3-dihydroxy-4-oxobutanoic acid (CAS 3019-58-7) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: (2R,3R)-4-anilino-2,3-dihydroxy-4-oxobutanoic acid. InChIKey: ZWXNRJCDXZFNLJ-HTQZYQBOSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | (2R,3R)-4-anilino-2,3-dihydroxy-4-oxobutanoic acid |
| InChIKey | ZWXNRJCDXZFNLJ-HTQZYQBOSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)[C@@H]([C@H](C(=O)O)O)O |
Computed by PubChem (NCBI)