cas: 3019-58-7 — see every product listed under this CAS number, including other names
(2R,3R)-Tartranilic Acid [for optical resolution], >98.0%(T) (CAS 3019-58-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T1702-1G |
| cas | 3019-58-7 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 319.95 Pln | |
| TCI | 5g | 1190.31 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
(2R,3R)-4-anilino-2,3-dihydroxy-4-oxobutanoic acid (CAS 3019-58-7) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: (2R,3R)-4-anilino-2,3-dihydroxy-4-oxobutanoic acid. InChIKey: ZWXNRJCDXZFNLJ-HTQZYQBOSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | (2R,3R)-4-anilino-2,3-dihydroxy-4-oxobutanoic acid |
| InChIKey | ZWXNRJCDXZFNLJ-HTQZYQBOSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)[C@@H]([C@H](C(=O)O)O)O |
Computed by PubChem (NCBI)