cas: 117384-45-9 — see every product listed under this CAS number, including other names
(2R,3R)-Di-tert-butyl 2,3-dihydroxysuccinate 98% (CAS 117384-45-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A901494-10g |
| cas | 117384-45-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 6377.88 Pln | |
| Ambeed | 100mg | 342.56 Pln | |
| Ambeed | 250mg | 520.56 Pln | |
| Ambeed | 1g | 1193.62 Pln | |
| Ambeed | 5g | 4008.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A901494 |
Ditert-butyl (2R,3R)-2,3-dihydroxybutanedioate (CAS 117384-45-9) is a chemical compound with the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. IUPAC name: ditert-butyl (2R,3R)-2,3-dihydroxybutanedioate. InChIKey: ITWOKJQQGHCDBL-HTQZYQBOSA-N.
| Molecular formula | C12H22O6 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | ditert-butyl (2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | ITWOKJQQGHCDBL-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]([C@H](C(=O)OC(C)(C)C)O)O |
Computed by PubChem (NCBI)