cas: 1018818-04-6 — see every product listed under this CAS number, including other names
(2R,4S)-1-(tert-Butoxycarbonyl)-4-methylpyrrolidine-2-carboxylic acid, 95%, 95% (CAS 1018818-04-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1116TM-1g |
| cas | 1018818-04-6 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2363.60 Pln | |
| Chemat | 100mg | 654.80 Pln | |
| Chemat | 250mg | 1005.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R,4S)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 1018818-04-6) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (2R,4S)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: MXKSXPYZNXUHEZ-JGVFFNPUSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (2R,4S)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | MXKSXPYZNXUHEZ-JGVFFNPUSA-N |
| SMILES | C[C@H]1C[C@@H](N(C1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)