CAS 245115-25-7 appears in our catalog under these names: (1R,2R)-2-(N-BOC-Amino)cyclopentanecarboxylic acid, 97%, (1R,2R)–2–((tert–Butoxycarbonyl)amino)cyclopentanecarboxylic acid, Boc-ACPC-OH (1R,2R), (1R,2R)-Boc-aminocyclopentane carboxylic acid, (1R,2R)-2-Boc-cyclopentanecarboxylic acid 95%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg, 2g, 25g, 100g.
Trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 245115-25-7) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: BUEPEVBYNBQNED-HTQZYQBOSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | BUEPEVBYNBQNED-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)