cas: 93423-88-2 — see every product listed under this CAS number, including other names
(2S)-1,2-PYRROLIDINEDICARBOXYLIC ACID-1-ETHYL-2-METHYL ESTER, >97%, >97% (CAS 93423-88-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RJ9-100mg |
| cas | 93423-88-2 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 774.80 Pln | |
| Chemat | 5g | 2363.60 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
1-O-ethyl 2-O-methyl (2S)-pyrrolidine-1,2-dicarboxylate (CAS 93423-88-2) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: 1-O-ethyl 2-O-methyl (2S)-pyrrolidine-1,2-dicarboxylate. InChIKey: YCWGTZNCRJOYQK-ZETCQYMHSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 1-O-ethyl 2-O-methyl (2S)-pyrrolidine-1,2-dicarboxylate |
| InChIKey | YCWGTZNCRJOYQK-ZETCQYMHSA-N |
| SMILES | CCOC(=O)N1CCC[C@H]1C(=O)OC |
Computed by PubChem (NCBI)