CAS 115491-96-8 appears in our catalog under these names: L-Valine, n-[(2-propen-1-yloxy)carbonyl]-, 95%, N–((Allyloxy)carbonyl)–L–valine, Alloc-Val-OH 95%, N-[(2-Propenyloxy)carbonyl]-L-valine, 95%, 95%, (S)-2-(((Allyloxy)carbonyl)amino)-3-methylbutanoic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 25g.
(2S)-3-methyl-2-(prop-2-enoxycarbonylamino)butanoic acid (CAS 115491-96-8) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: (2S)-3-methyl-2-(prop-2-enoxycarbonylamino)butanoic acid. InChIKey: MQKQMLUPZZNVCK-ZETCQYMHSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | (2S)-3-methyl-2-(prop-2-enoxycarbonylamino)butanoic acid |
| InChIKey | MQKQMLUPZZNVCK-ZETCQYMHSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)OCC=C |
Computed by PubChem (NCBI)