Products 407634-06-4

CAS 407634-06-4 is the registry number for 1-(3-Methoxypropyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-(3-methoxypropyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 407634-06-4) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: 1-(3-methoxypropyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: IULBBAKLFCDXJH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15NO4
Molecular weight201.22 g/mol
IUPAC name1-(3-methoxypropyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyIULBBAKLFCDXJH-UHFFFAOYSA-N
SMILESCOCCCN1CC(CC1=O)C(=O)O

Computed by PubChem (NCBI)