CAS 1239355-46-4 appears in our catalog under these names: (R)-Methyl 1-N-Boc-aziridine-2-carboxylate, 96%, (R)–1–tert–Butyl 2–methyl aziridine–1,2–dicarboxylate, 1-tert-butyl 2-methyl (2R)-aziridine-1,2-dicarboxylate, 97%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g.
1-O-tert-butyl 2-O-methyl (2R)-aziridine-1,2-dicarboxylate (CAS 1239355-46-4) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R)-aziridine-1,2-dicarboxylate. InChIKey: OHKDZMSOHBQKDL-ZMMDDIOLSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R)-aziridine-1,2-dicarboxylate |
| InChIKey | OHKDZMSOHBQKDL-ZMMDDIOLSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)